Products 2109703-28-6
CAS 2109703-28-6 is the registry number for Ethyl 5-Bromo-4-nitro-1H-pyrrole-2-carboxylate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 5-bromo-4-nitro-1H-pyrrole-2-carboxylate (CAS 2109703-28-6) is a chemical compound with the molecular formula C7H7BrN2O4 and a molecular weight of 263.05 g/mol. IUPAC name: ethyl 5-bromo-4-nitro-1H-pyrrole-2-carboxylate. InChIKey: IVTMHEADIDKEQE-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O4 |
|---|---|
| Molecular weight | 263.05 g/mol |
| IUPAC name | ethyl 5-bromo-4-nitro-1H-pyrrole-2-carboxylate |
| InChIKey | IVTMHEADIDKEQE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)