Products 210979-33-2
CAS 210979-33-2 appears in our catalog under these names: 17–trans Prostaglandin E3, 17-trans Prostaglandin E3. Offered by: GLPBio, MedChemExpress. Available pack sizes: 25μg, 50μg, 100μg, Get quote.
(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(1E,3S,5E)-3-hydroxyocta-1,5-dienyl]-5-oxocyclopentyl]hept-5-enoic acid (CAS 210979-33-2) is a chemical compound with the molecular formula C20H30O5 and a molecular weight of 350.4 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(1E,3S,5E)-3-hydroxyocta-1,5-dienyl]-5-oxocyclopentyl]hept-5-enoic acid. InChIKey: CBOMORHDRONZRN-YYFRSVFISA-N.
| Molecular formula | C20H30O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(1E,3S,5E)-3-hydroxyocta-1,5-dienyl]-5-oxocyclopentyl]hept-5-enoic acid |
| InChIKey | CBOMORHDRONZRN-YYFRSVFISA-N |
| SMILES | CC/C=C/C[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1C/C=C\CCCC(=O)O)O)O |
Computed by PubChem (NCBI)