CAS 2110276-43-0 is the registry number for 5-Bromo-4,8-difluoroquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4,8-difluoroquinazoline (CAS 2110276-43-0) is a chemical compound with the molecular formula C8H3BrF2N2 and a molecular weight of 245.02 g/mol. IUPAC name: 5-bromo-4,8-difluoroquinazoline. InChIKey: OJHZSXOCCJPIOP-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF2N2 |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | 5-bromo-4,8-difluoroquinazoline |
| InChIKey | OJHZSXOCCJPIOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)N=CN=C2F)Br |
Computed by PubChem (NCBI)