CAS 2767413-31-8 is the registry number for 8-Bromo-2,3-difluoro-1,5-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-2,3-difluoro-1,5-naphthyridine (CAS 2767413-31-8) is a chemical compound with the molecular formula C8H3BrF2N2 and a molecular weight of 245.02 g/mol. IUPAC name: 8-bromo-2,3-difluoro-1,5-naphthyridine. InChIKey: NADMTFVTXGGPOR-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF2N2 |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | 8-bromo-2,3-difluoro-1,5-naphthyridine |
| InChIKey | NADMTFVTXGGPOR-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C(=NC2=C1Br)F)F |
Computed by PubChem (NCBI)