CAS 2759951-38-5 is the registry number for 7-Bromo-4,6-difluorocinnoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4,6-difluorocinnoline (CAS 2759951-38-5) is a chemical compound with the molecular formula C8H3BrF2N2 and a molecular weight of 245.02 g/mol. IUPAC name: 7-bromo-4,6-difluorocinnoline. InChIKey: SZFLOTSHXCTZNN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF2N2 |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | 7-bromo-4,6-difluorocinnoline |
| InChIKey | SZFLOTSHXCTZNN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Br)N=NC=C2F |
Computed by PubChem (NCBI)