Products 211105-23-6
CAS 211105-23-6 appears in our catalog under these names: Prostaglandin B2–d4, Prostaglandin B2-d4. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 100μg, 50μg, 500μg, 50 μg.
(Z)-3,3,4,4-tetradeuterio-7-[2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoic acid (CAS 211105-23-6) is a chemical compound with the molecular formula C20H30O4 and a molecular weight of 338.5 g/mol. IUPAC name: (Z)-3,3,4,4-tetradeuterio-7-[2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoic acid. InChIKey: PRFXRIUZNKLRHM-GKNRUGNGSA-N.
| Molecular formula | C20H30O4 |
|---|---|
| Molecular weight | 338.5 g/mol |
| IUPAC name | (Z)-3,3,4,4-tetradeuterio-7-[2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoic acid |
| InChIKey | PRFXRIUZNKLRHM-GKNRUGNGSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])/C=C\CC1=C(CCC1=O)/C=C/[C@H](CCCCC)O |
Computed by PubChem (NCBI)