CAS 2111055-45-7 appears in our catalog under these names: 5-(1H-Indol-4-yl)-1h-pyrrole-2-carboxylic acid, 95%, 5–(1H–Indol–4–yl)–1H–pyrrole–2–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 5g, 1g, 250mg.
5-(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid (CAS 2111055-45-7) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 5-(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid. InChIKey: FHHQROROLLIYIS-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 5-(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | FHHQROROLLIYIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CNC2=C1)C3=CC=C(N3)C(=O)O |
Computed by PubChem (NCBI)