Products 2111348-12-8
CAS 2111348-12-8 is the registry number for ethyl 2-(7-chloro-1-methyl-imidazo[1,5-a]pyridin-3-yl)acetate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Ethyl 2-(7-chloro-1-methylimidazo[1,5-a]pyridin-3-yl)acetate (CAS 2111348-12-8) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: ethyl 2-(7-chloro-1-methylimidazo[1,5-a]pyridin-3-yl)acetate. InChIKey: YKCXLLWHHIMSNX-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O2 |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | ethyl 2-(7-chloro-1-methylimidazo[1,5-a]pyridin-3-yl)acetate |
| InChIKey | YKCXLLWHHIMSNX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC(=C2N1C=CC(=C2)Cl)C |
Computed by PubChem (NCBI)