Products 21115-77-5
CAS 21115-77-5 is the registry number for 1,5,10-Trimethylcyclododeca-1,5,9-triene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1Z,5Z,9Z)-1,5,10-trimethylcyclododeca-1,5,9-triene (CAS 21115-77-5) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1Z,5Z,9Z)-1,5,10-trimethylcyclododeca-1,5,9-triene. InChIKey: DRDYICOUDVAVGE-MSKXPCFJSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1Z,5Z,9Z)-1,5,10-trimethylcyclododeca-1,5,9-triene |
| InChIKey | DRDYICOUDVAVGE-MSKXPCFJSA-N |
| SMILES | C/C/1=C/CC/C=C(\CC/C(=C\CC1)/C)/C |
Computed by PubChem (NCBI)