Products 2112190-69-7

CAS 2112190-69-7 is the registry number for 2-(tert-Butyl) 8-ethyl 2,7-diazaspiro(4.4)nonane-2,8-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 8-O-ethyl 2,7-diazaspiro[4.4]nonane-2,8-dicarboxylate (CAS 2112190-69-7) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 8-O-ethyl 2,7-diazaspiro[4.4]nonane-2,8-dicarboxylate. InChIKey: DNPWRZPNGUCNCM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O4
Molecular weight298.38 g/mol
IUPAC name2-O-tert-butyl 8-O-ethyl 2,7-diazaspiro[4.4]nonane-2,8-dicarboxylate
InChIKeyDNPWRZPNGUCNCM-UHFFFAOYSA-N
SMILESCCOC(=O)C1CC2(CCN(C2)C(=O)OC(C)(C)C)CN1

Computed by PubChem (NCBI)