Products 2112593-96-9

CAS 2112593-96-9 is the registry number for Ethyl 2-phenylpiperidine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-phenylpiperidine-2-carboxylate (CAS 2112593-96-9) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: ethyl 2-phenylpiperidine-2-carboxylate. InChIKey: FAGCPLSNCLNQNA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO2
Molecular weight233.31 g/mol
IUPAC nameethyl 2-phenylpiperidine-2-carboxylate
InChIKeyFAGCPLSNCLNQNA-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCCCN1)C2=CC=CC=C2

Computed by PubChem (NCBI)