CAS 2112766-33-1 is the registry number for (2E)-3-(3-Chloro-1-benzothiophen-2-yl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoic acid (CAS 2112766-33-1) is a chemical compound with the molecular formula C11H7ClO2S and a molecular weight of 238.69 g/mol. IUPAC name: (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoic acid. InChIKey: ZJLYCHHRWGBDAH-AATRIKPKSA-N.
| Molecular formula | C11H7ClO2S |
|---|---|
| Molecular weight | 238.69 g/mol |
| IUPAC name | (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoic acid |
| InChIKey | ZJLYCHHRWGBDAH-AATRIKPKSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)