Products 211315-05-8
CAS 211315-05-8 appears in our catalog under these names: 1-(4-tert-Butylphenyl)cyclopropanecarboxylic acid, 95%, 1-(4-tert-Butylphenyl)cyclopropane-1-carboxylic acid, 1-(4-tert-Butylphenyl)cyclopropanecarboxylic acid, 95%+, 95%+. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid (CAS 211315-05-8) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: 1-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid. InChIKey: AYUZKGVLRKUOAP-UHFFFAOYSA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | AYUZKGVLRKUOAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2(CC2)C(=O)O |
Computed by PubChem (NCBI)