Products 3894-09-5
CAS 3894-09-5 appears in our catalog under these names: Cyclohexylphenylacetic acid, 95%, alpha-Cyclohexyl-benzeneacetic Acid, alpha-Cyclohexylphenylacetic Acid, >95.0%(GC)(T), 2-Cyclohexyl-2-phenylacetic acid 95%, 2-Cyclohexyl-2-phenylacetic acid, 95%, 95%. Offered by: Combi-blocks, TRC, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 250mg, 100mg.
2-cyclohexyl-2-phenylacetic acid (CAS 3894-09-5) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: 2-cyclohexyl-2-phenylacetic acid. InChIKey: AAJLPPDFIRPBDA-UHFFFAOYSA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 2-cyclohexyl-2-phenylacetic acid |
| InChIKey | AAJLPPDFIRPBDA-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Cyclohexylphenylacetic acid, 2-cyclohexyl-2-phenylacetic acid, alpha-Cyclohexylphenylacetic acid, a-Cyclohexylphenylacetic acid, cyclohexyl(phenyl)acetic acid, alpha-Cyclohexyl-benzeneacetic Acid, alpha-Phenylcyclohexylacetic acid, cyclohexyl-phenylacetic acid, cyclohexyl-phenyl-acetic acid, a-Cyclohexyl-benzeneacetic Acid