Products 2504202-32-6

CAS 2504202-32-6 is the registry number for 2-Methyl-5-vinyl-benzoic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-ethenyl-2-methylbenzoate (CAS 2504202-32-6) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: tert-butyl 5-ethenyl-2-methylbenzoate. InChIKey: IEBDQKMXDXKPKF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O2
Molecular weight218.29 g/mol
IUPAC nametert-butyl 5-ethenyl-2-methylbenzoate
InChIKeyIEBDQKMXDXKPKF-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C=C)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)