Products 72369-89-2
CAS 72369-89-2 appears in our catalog under these names: 5-O-Benzyl-d-ribose, 95%, 5-O-Benzyl-D-ribose, >95% (HPLC), (2R,3R,4R)–5–(benzyloxy)–2,3,4–trihydroxypentanal, 5-O-Benzyl-D-ribose, 5-O-(Phenylmethyl)-D-ribose. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 500mg, 100mg, 50mg, 250 mg, 1 g, 100 mg.
(2R,3R,4R)-2,3,4-trihydroxy-5-phenylmethoxypentanal (CAS 72369-89-2) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: (2R,3R,4R)-2,3,4-trihydroxy-5-phenylmethoxypentanal. InChIKey: SMERYXWDIUSMOF-TUAOUCFPSA-N.
| Molecular formula | C12H16O5 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (2R,3R,4R)-2,3,4-trihydroxy-5-phenylmethoxypentanal |
| InChIKey | SMERYXWDIUSMOF-TUAOUCFPSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H]([C@H]([C@H](C=O)O)O)O |
Computed by PubChem (NCBI)