CAS 2114761-87-2 is the registry number for Ethyl 4-fluoro-3-methoxy-5-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
Ethyl 4-fluoro-3-methoxy-5-methylbenzoate (CAS 2114761-87-2) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: ethyl 4-fluoro-3-methoxy-5-methylbenzoate. InChIKey: MVRMZKWCLHMOLL-UHFFFAOYSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | ethyl 4-fluoro-3-methoxy-5-methylbenzoate |
| InChIKey | MVRMZKWCLHMOLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C)F)OC |
Computed by PubChem (NCBI)