CAS 211495-85-1 appears in our catalog under these names: Silanediol, dicyclopentyl-, 95%, 1,1-Dicyclopentylsilanediol, dicyclopentylsilanediol, Dicyclopentylsilanediol 95%, SILANEDIOL, DICYCLOPENTYL-, 95%,RG. Offered by: Combi-blocks, Chemat Brand, GLPBio, Ambeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, on request, 100mg, 10g, 25g.
Dicyclopentyl(dihydroxy)silane (CAS 211495-85-1) is a chemical compound with the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. IUPAC name: dicyclopentyl(dihydroxy)silane. InChIKey: KKCJXDUBNUSNTR-UHFFFAOYSA-N.
| Molecular formula | C10H20O2Si |
|---|---|
| Molecular weight | 200.35 g/mol |
| IUPAC name | dicyclopentyl(dihydroxy)silane |
| InChIKey | KKCJXDUBNUSNTR-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)[Si](C2CCCC2)(O)O |
Computed by PubChem (NCBI)