CAS 90660-09-6 is the registry number for 1-(T-butyldimethylsilyloxy)cyclopropanecarbaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1-[tert-butyl(dimethyl)silyl]oxycyclopropane-1-carbaldehyde (CAS 90660-09-6) is a chemical compound with the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. IUPAC name: 1-[tert-butyl(dimethyl)silyl]oxycyclopropane-1-carbaldehyde. InChIKey: USEPQADZZXOVBD-UHFFFAOYSA-N.
| Molecular formula | C10H20O2Si |
|---|---|
| Molecular weight | 200.35 g/mol |
| IUPAC name | 1-[tert-butyl(dimethyl)silyl]oxycyclopropane-1-carbaldehyde |
| InChIKey | USEPQADZZXOVBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1(CC1)C=O |
Computed by PubChem (NCBI)