CAS 86120-46-9 appears in our catalog under these names: 4-((tert-butyldimethylsilyl)oxy)but-2-yn-1-ol, 95%, 4-((tert-Butyldimethylsilyl)oxy)but-2-yn-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
4-[tert-butyl(dimethyl)silyl]oxybut-2-yn-1-ol (CAS 86120-46-9) is a chemical compound with the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxybut-2-yn-1-ol. InChIKey: TVWVWXDQNWGYJZ-UHFFFAOYSA-N.
| Molecular formula | C10H20O2Si |
|---|---|
| Molecular weight | 200.35 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxybut-2-yn-1-ol |
| InChIKey | TVWVWXDQNWGYJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CCO |
Computed by PubChem (NCBI)