CAS 2114966-31-1 appears in our catalog under these names: 3-(tert-Butyl) 1-methyl 3-azabicyclo(3.2.1)octane-1,3-dicarboxylate, 97%, 3-tert-butyl 1-methyl 3-azabicyclo[3.2.1]octane-1,3-dicarboxylate, 97%, 97%, 3-TERT-BUTYL 1-METHYL 3-AZABICYCLO[3.2.1]OCTANE-1,3-DICARBOXYLATE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
3-O-tert-butyl 1-O-methyl 3-azabicyclo[3.2.1]octane-1,3-dicarboxylate (CAS 2114966-31-1) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 3-O-tert-butyl 1-O-methyl 3-azabicyclo[3.2.1]octane-1,3-dicarboxylate. InChIKey: VRDRVUUHZJQGGO-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 3-O-tert-butyl 1-O-methyl 3-azabicyclo[3.2.1]octane-1,3-dicarboxylate |
| InChIKey | VRDRVUUHZJQGGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(C2)(C1)C(=O)OC |
Computed by PubChem (NCBI)