Products 2115107-14-5
CAS 2115107-14-5 is the registry number for 5-[(4-Carboxyphenoxy)methyl]-1,3-benzenedicarboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-[(4-carboxyphenoxy)methyl]benzene-1,3-dicarboxylic acid (CAS 2115107-14-5) is a chemical compound with the molecular formula C16H12O7 and a molecular weight of 316.26 g/mol. IUPAC name: 5-[(4-carboxyphenoxy)methyl]benzene-1,3-dicarboxylic acid. InChIKey: CSWXLGQUCGKSEH-UHFFFAOYSA-N.
| Molecular formula | C16H12O7 |
|---|---|
| Molecular weight | 316.26 g/mol |
| IUPAC name | 5-[(4-carboxyphenoxy)methyl]benzene-1,3-dicarboxylic acid |
| InChIKey | CSWXLGQUCGKSEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCC2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)