CAS 2116300-00-4 is the registry number for 3,7-Dimethylisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,7-dimethylisoquinoline (CAS 2116300-00-4) is a chemical compound with the molecular formula C11H11N and a molecular weight of 157.21 g/mol. IUPAC name: 3,7-dimethylisoquinoline. InChIKey: UGDBAADRKHLXQS-UHFFFAOYSA-N.
| Molecular formula | C11H11N |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | 3,7-dimethylisoquinoline |
| InChIKey | UGDBAADRKHLXQS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(N=C2)C |
Computed by PubChem (NCBI)