Products 2117241-06-0
CAS 2117241-06-0 is the registry number for Ethyl 5-chlorobenzo[b]thiophene-7-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Ethyl 5-chloro-1-benzothiophene-7-carboxylate (CAS 2117241-06-0) is a chemical compound with the molecular formula C11H9ClO2S and a molecular weight of 240.71 g/mol. IUPAC name: ethyl 5-chloro-1-benzothiophene-7-carboxylate. InChIKey: UWEXYLALOYRRNA-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | ethyl 5-chloro-1-benzothiophene-7-carboxylate |
| InChIKey | UWEXYLALOYRRNA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=CC(=C1)Cl)C=CS2 |
Computed by PubChem (NCBI)