Products 21175-64-4
CAS 21175-64-4 appears in our catalog under these names: Benzyl-alpha,alpha-d2 Alcohol, 98 atom % D, min 98% Chemical Purity, Benzyl-Alpha,Alpha-d2 Alcohol, Benzyl-α,α-d2 Alcohol, Phenylmethan–d2–ol, Benzyl-alpha,alpha-d2 alcohol, 98 atom &. Offered by: CDN, TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10mg, 50mg, 5mg, 100mg, 25mg, 1G.
Dideuterio(phenyl)methanol (CAS 21175-64-4) is a chemical compound with the molecular formula C7H8O and a molecular weight of 110.15 g/mol. IUPAC name: dideuterio(phenyl)methanol. InChIKey: WVDDGKGOMKODPV-NCYHJHSESA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 110.15 g/mol |
| IUPAC name | dideuterio(phenyl)methanol |
| InChIKey | WVDDGKGOMKODPV-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(C1=CC=CC=C1)O |
Computed by PubChem (NCBI)