CAS 71258-23-6 appears in our catalog under these names: Benzyl-d7 Alcohol, 99 atom % D, min 98% Chemical Purity, Benzyl-d7 Alcohol, >95% (HPLC), Benzyl–d7 alcohol, BENZYL-D7 ALCOHOL, 98 ATOM % D, Benzyl alcohol-d7, 99.56%. Offered by: CDN, TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100mg, 10mg, 50mg, 25mg, 1G, 25 mg.
Dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanol (CAS 71258-23-6) is a chemical compound with the molecular formula C7H8O and a molecular weight of 115.18 g/mol. IUPAC name: dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanol. InChIKey: WVDDGKGOMKODPV-XZJKGWKKSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 115.18 g/mol |
| IUPAC name | dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanol |
| InChIKey | WVDDGKGOMKODPV-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])O)[2H])[2H] |
Computed by PubChem (NCBI)