CAS 68661-10-9 appears in our catalog under these names: Benzyl-2,3,4,5,6-D5 Alcohol, >95% (GC), Benzyl-2,3,4,5,6-d5 Alcohol, 99 atom % D, min 98% Chemical Purity, Benzyl–2,3,4,5,6–D5 Alcohol, Benzyl alcohol–d5, BENZYL-2,3,4,5,6-D5, ALCOHOL, 98 ATOM %&. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1g, 25mg, 250MG, 50 mg, 25 mg.
(2,3,4,5,6-pentadeuteriophenyl)methanol (CAS 68661-10-9) is a chemical compound with the molecular formula C7H8O and a molecular weight of 113.17 g/mol. IUPAC name: (2,3,4,5,6-pentadeuteriophenyl)methanol. InChIKey: WVDDGKGOMKODPV-RALIUCGRSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 113.17 g/mol |
| IUPAC name | (2,3,4,5,6-pentadeuteriophenyl)methanol |
| InChIKey | WVDDGKGOMKODPV-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CO)[2H])[2H] |
Computed by PubChem (NCBI)