CAS 21182-09-2 is the registry number for 3,3'-(Pyridin-4-ylmethylene)bis(1H-indole), >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 25mg, 500mg.
3-[1H-indol-3-yl(pyridin-4-yl)methyl]-1H-indole (CAS 21182-09-2) is a chemical compound with the molecular formula C22H17N3 and a molecular weight of 323.4 g/mol. IUPAC name: 3-[1H-indol-3-yl(pyridin-4-yl)methyl]-1H-indole. InChIKey: DQQBRWQAKQZTQY-UHFFFAOYSA-N.
| Molecular formula | C22H17N3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 3-[1H-indol-3-yl(pyridin-4-yl)methyl]-1H-indole |
| InChIKey | DQQBRWQAKQZTQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(C3=CC=NC=C3)C4=CNC5=CC=CC=C54 |
Computed by PubChem (NCBI)