CAS 2732874-47-2 is the registry number for 3′,5′-Di-4-pyridinyl[1,1′-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
4-(3,5-dipyridin-4-ylphenyl)aniline (CAS 2732874-47-2) is a chemical compound with the molecular formula C22H17N3 and a molecular weight of 323.4 g/mol. IUPAC name: 4-(3,5-dipyridin-4-ylphenyl)aniline. InChIKey: GSLCJFDKUCKXJB-UHFFFAOYSA-N.
| Molecular formula | C22H17N3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 4-(3,5-dipyridin-4-ylphenyl)aniline |
| InChIKey | GSLCJFDKUCKXJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C3=CC=NC=C3)C4=CC=NC=C4)N |
Computed by PubChem (NCBI)