Products 31696-84-1
CAS 31696-84-1 appears in our catalog under these names: 2,4-Diphenyl-6-(o-tolyl)-1,3,5-triazine, 98%, 2-(2-Methylphenyl)-4,6-diphenyl-1,3,5-triazine, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg, 100mg, 250mg.
2-(2-methylphenyl)-4,6-diphenyl-1,3,5-triazine (CAS 31696-84-1) is a chemical compound with the molecular formula C22H17N3 and a molecular weight of 323.4 g/mol. IUPAC name: 2-(2-methylphenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: SWUGNDCSSFOYEZ-UHFFFAOYSA-N.
| Molecular formula | C22H17N3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-(2-methylphenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | SWUGNDCSSFOYEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NC(=NC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)