CAS 2119341-47-6 is the registry number for Methyl 2-(methylthio)benzo[d]thiazole-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-methylsulfanyl-1,3-benzothiazole-6-carboxylate (CAS 2119341-47-6) is a chemical compound with the molecular formula C10H9NO2S2 and a molecular weight of 239.3 g/mol. IUPAC name: methyl 2-methylsulfanyl-1,3-benzothiazole-6-carboxylate. InChIKey: LRSCFIQLVGBWEX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S2 |
|---|---|
| Molecular weight | 239.3 g/mol |
| IUPAC name | methyl 2-methylsulfanyl-1,3-benzothiazole-6-carboxylate |
| InChIKey | LRSCFIQLVGBWEX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=C(S2)SC |
Computed by PubChem (NCBI)