CAS 314032-13-8 is the registry number for 2-(2-Methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid (CAS 314032-13-8) is a chemical compound with the molecular formula C10H9NO2S2 and a molecular weight of 239.3 g/mol. IUPAC name: 2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid. InChIKey: SQRSWZAVFSYARR-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S2 |
|---|---|
| Molecular weight | 239.3 g/mol |
| IUPAC name | 2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid |
| InChIKey | SQRSWZAVFSYARR-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)CC(=O)O)C2=CC=CS2 |
Computed by PubChem (NCBI)