Products 314032-13-8

CAS 314032-13-8 is the registry number for 2-(2-Methyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid (CAS 314032-13-8) is a chemical compound with the molecular formula C10H9NO2S2 and a molecular weight of 239.3 g/mol. IUPAC name: 2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid. InChIKey: SQRSWZAVFSYARR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO2S2
Molecular weight239.3 g/mol
IUPAC name2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid
InChIKeySQRSWZAVFSYARR-UHFFFAOYSA-N
SMILESCC1=NC(=C(S1)CC(=O)O)C2=CC=CS2

Computed by PubChem (NCBI)