Products 924868-89-3

CAS 924868-89-3 is the registry number for 2-[5-Methyl-2-(2-thienyl)-1,3-thiazol-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid (CAS 924868-89-3) is a chemical compound with the molecular formula C10H9NO2S2 and a molecular weight of 239.3 g/mol. IUPAC name: 2-(5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid. InChIKey: CEVZCINETUGVRV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO2S2
Molecular weight239.3 g/mol
IUPAC name2-(5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid
InChIKeyCEVZCINETUGVRV-UHFFFAOYSA-N
SMILESCC1=C(N=C(S1)C2=CC=CS2)CC(=O)O

Computed by PubChem (NCBI)