CAS 924868-89-3 is the registry number for 2-[5-Methyl-2-(2-thienyl)-1,3-thiazol-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
2-(5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid (CAS 924868-89-3) is a chemical compound with the molecular formula C10H9NO2S2 and a molecular weight of 239.3 g/mol. IUPAC name: 2-(5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid. InChIKey: CEVZCINETUGVRV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S2 |
|---|---|
| Molecular weight | 239.3 g/mol |
| IUPAC name | 2-(5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid |
| InChIKey | CEVZCINETUGVRV-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=CC=CS2)CC(=O)O |
Computed by PubChem (NCBI)