Products 2121513-86-6
CAS 2121513-86-6 appears in our catalog under these names: 2-Fluoro-3-methoxypyridine-4-boronic acid pinacol ester, 2-Fluoro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 0,5g, 5g, 250mg, 1g.
2-fluoro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121513-86-6) is a chemical compound with the molecular formula C12H17BFNO3 and a molecular weight of 253.08 g/mol. IUPAC name: 2-fluoro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: NCKNLZMVHKITGV-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO3 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 2-fluoro-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | NCKNLZMVHKITGV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)F)OC |
Computed by PubChem (NCBI)