CAS 2121514-32-5 is the registry number for 2-Fluoro-5-hydroxypyridine-4-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol (CAS 2121514-32-5) is a chemical compound with the molecular formula C11H15BFNO3 and a molecular weight of 239.05 g/mol. IUPAC name: 6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol. InChIKey: UXYJVTCOIZSRLB-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO3 |
|---|---|
| Molecular weight | 239.05 g/mol |
| IUPAC name | 6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol |
| InChIKey | UXYJVTCOIZSRLB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2O)F |
Computed by PubChem (NCBI)