CAS 2121514-83-6 appears in our catalog under these names: 2,5-Difluoro-4-benzyloxyphenylboronic acid pinacol ester, 95%, 2-(4-(Benzyloxy)-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-(2,5-difluoro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-83-6) is a chemical compound with the molecular formula C19H21BF2O3 and a molecular weight of 346.2 g/mol. IUPAC name: 2-(2,5-difluoro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XPIOLPHZLKMREE-UHFFFAOYSA-N.
| Molecular formula | C19H21BF2O3 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 2-(2,5-difluoro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XPIOLPHZLKMREE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)OCC3=CC=CC=C3)F |
Computed by PubChem (NCBI)