CAS 2375195-52-9 appears in our catalog under these names: 3-Benzyloxy-2,6-difluorophenylbornic acid pinacol ester, 95%, 2-(3-(Benzyloxy)-2,6-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
2-(2,6-difluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2375195-52-9) is a chemical compound with the molecular formula C19H21BF2O3 and a molecular weight of 346.2 g/mol. IUPAC name: 2-(2,6-difluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JUGLHYVPIYMQHJ-UHFFFAOYSA-N.
| Molecular formula | C19H21BF2O3 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 2-(2,6-difluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JUGLHYVPIYMQHJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)OCC3=CC=CC=C3)F |
Computed by PubChem (NCBI)