CAS 2121515-12-4 appears in our catalog under these names: 4-(Benzyloxy)-2,3-difluorophenylboronic acid pinacol ester, ≥95%, 4-(Benzyloxy)-2,3-difluorophenylboronic acid pinacol ester, ≥95%, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
2-(2,3-difluoro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121515-12-4) is a chemical compound with the molecular formula C19H21BF2O3 and a molecular weight of 346.2 g/mol. IUPAC name: 2-(2,3-difluoro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GDADQWZJMSNSSN-UHFFFAOYSA-N.
| Molecular formula | C19H21BF2O3 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 2-(2,3-difluoro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GDADQWZJMSNSSN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)OCC3=CC=CC=C3)F)F |
Computed by PubChem (NCBI)