Products 212184-27-5
CAS 212184-27-5 is the registry number for 4-((tert-Butoxycarbonyl)amino)-3-methoxy-1-methyl-1H-pyrrole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methoxy-1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-2-carboxylic acid (CAS 212184-27-5) is a chemical compound with the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. IUPAC name: 3-methoxy-1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-2-carboxylic acid. InChIKey: JPOMZFNBINJENV-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O5 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 3-methoxy-1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-2-carboxylic acid |
| InChIKey | JPOMZFNBINJENV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN(C(=C1OC)C(=O)O)C |
Computed by PubChem (NCBI)