CAS 21473-40-5 appears in our catalog under these names: N3-Ethylthymidine, N3-Ethylthymidine-d5. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 100mg, 50mg.
3-ethyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 21473-40-5) is a chemical compound with the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. IUPAC name: 3-ethyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: KZLQMOZKJBGROV-IVZWLZJFSA-N.
| Molecular formula | C12H18N2O5 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 3-ethyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | KZLQMOZKJBGROV-IVZWLZJFSA-N |
| SMILES | CCN1C(=O)C(=CN(C1=O)[C@H]2C[C@@H]([C@H](O2)CO)O)C |
Computed by PubChem (NCBI)