CAS 59495-22-6 is the registry number for O4-Ethylthymidine. Offered by: TRC. Available pack sizes: 250mg, 25mg.
4-ethoxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one (CAS 59495-22-6) is a chemical compound with the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. IUPAC name: 4-ethoxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one. InChIKey: QZVVYDMWOGPALV-IVZWLZJFSA-N.
| Molecular formula | C12H18N2O5 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 4-ethoxy-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
| InChIKey | QZVVYDMWOGPALV-IVZWLZJFSA-N |
| SMILES | CCOC1=NC(=O)N(C=C1C)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)