Products 2121989-56-6
CAS 2121989-56-6 appears in our catalog under these names: beta-(4-Chlorophenoxy)-alpha-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol-d4, Triadimenol D4 (phenoxy D4), Triadimenol-d4 (4-chlorophenoxy-d4) (mixture of stereoisomers), 98 atom % D, min 98% Chemical Purity, Triadimenol–d4, Triadimenol-d4, 99.49%. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, MedChemExpress. Available pack sizes: 25mg, 10mg, 0,01g, 0,005g, 500μg, 1mg, 500 μg, 1 mg.
1-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 2121989-56-6) is a chemical compound with the molecular formula C14H18ClN3O2 and a molecular weight of 299.79 g/mol. IUPAC name: 1-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: BAZVSMNPJJMILC-UGWFXTGHSA-N.
| Molecular formula | C14H18ClN3O2 |
|---|---|
| Molecular weight | 299.79 g/mol |
| IUPAC name | 1-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | BAZVSMNPJJMILC-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC(C(C(C)(C)C)O)N2C=NC=N2)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)