Products 70585-37-4
CAS 70585-37-4 is the registry number for Triadimenol isomer B 100 µg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
(1S,2S)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 70585-37-4) is a chemical compound with the molecular formula C14H18ClN3O2 and a molecular weight of 295.76 g/mol. IUPAC name: (1S,2S)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: BAZVSMNPJJMILC-OLZOCXBDSA-N.
| Molecular formula | C14H18ClN3O2 |
|---|---|
| Molecular weight | 295.76 g/mol |
| IUPAC name | (1S,2S)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | BAZVSMNPJJMILC-OLZOCXBDSA-N |
| SMILES | CC(C)(C)[C@@H]([C@@H](N1C=NC=N1)OC2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)