Products 2122837-27-6
CAS 2122837-27-6 is the registry number for 1,1-Dimethylethyl N-[(3S)-1-[(dimethylamino)carbonyl]-3-pyrrolidinyl]carbamate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl N-[(3S)-1-(dimethylcarbamoyl)pyrrolidin-3-yl]carbamate (CAS 2122837-27-6) is a chemical compound with the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. IUPAC name: tert-butyl N-[(3S)-1-(dimethylcarbamoyl)pyrrolidin-3-yl]carbamate. InChIKey: FHUBDEHTPCQZNQ-VIFPVBQESA-N.
| Molecular formula | C12H23N3O3 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | tert-butyl N-[(3S)-1-(dimethylcarbamoyl)pyrrolidin-3-yl]carbamate |
| InChIKey | FHUBDEHTPCQZNQ-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(C1)C(=O)N(C)C |
Computed by PubChem (NCBI)