CAS 212504-90-0 is the registry number for Oseltamivir Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R,5S)-4,5-diamino-3-pentan-3-yloxycyclohexene-1-carboxylic acid (CAS 212504-90-0) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: (3R,4R,5S)-4,5-diamino-3-pentan-3-yloxycyclohexene-1-carboxylic acid. InChIKey: RNQDCSINGDYZIY-HBNTYKKESA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | (3R,4R,5S)-4,5-diamino-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| InChIKey | RNQDCSINGDYZIY-HBNTYKKESA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1N)N)C(=O)O |
Computed by PubChem (NCBI)