Products 212504-90-0

CAS 212504-90-0 is the registry number for Oseltamivir Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3R,4R,5S)-4,5-diamino-3-pentan-3-yloxycyclohexene-1-carboxylic acid (CAS 212504-90-0) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: (3R,4R,5S)-4,5-diamino-3-pentan-3-yloxycyclohexene-1-carboxylic acid. InChIKey: RNQDCSINGDYZIY-HBNTYKKESA-N.

Identity
Molecular formulaC12H22N2O3
Molecular weight242.31 g/mol
IUPAC name(3R,4R,5S)-4,5-diamino-3-pentan-3-yloxycyclohexene-1-carboxylic acid
InChIKeyRNQDCSINGDYZIY-HBNTYKKESA-N
SMILESCCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1N)N)C(=O)O

Computed by PubChem (NCBI)