CAS 2125500-35-6 is the registry number for Rel-Methyl (1R,6R)-6-((tert-butoxycarbonyl)amino)cyclohex-3-ene-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 100mg, 10g.
Methyl (1R,6R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylate (CAS 2125500-35-6) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: methyl (1R,6R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylate. InChIKey: RZIDCDXFSTUXMB-NXEZZACHSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | methyl (1R,6R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylate |
| InChIKey | RZIDCDXFSTUXMB-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC=CC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)