CAS 212556-43-9 is the registry number for 1,1,1-Trifluoropropan-2-yl trifluoromethanesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1,1,1-trifluoropropan-2-yl trifluoromethanesulfonate (CAS 212556-43-9) is a chemical compound with the molecular formula C4H4F6O3S and a molecular weight of 246.13 g/mol. IUPAC name: 1,1,1-trifluoropropan-2-yl trifluoromethanesulfonate. InChIKey: CCCKOEYCRHBDDH-UHFFFAOYSA-N.
| Molecular formula | C4H4F6O3S |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 1,1,1-trifluoropropan-2-yl trifluoromethanesulfonate |
| InChIKey | CCCKOEYCRHBDDH-UHFFFAOYSA-N |
| SMILES | CC(C(F)(F)F)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)