Products 25236-65-1
CAS 25236-65-1 is the registry number for 1,1,1,3,3,3-Hexafluoro-2-propyl mesylate, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1,1,1,3,3,3-hexafluoropropan-2-yl methanesulfonate (CAS 25236-65-1) is a chemical compound with the molecular formula C4H4F6O3S and a molecular weight of 246.13 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoropropan-2-yl methanesulfonate. InChIKey: ASXXTXSBHCZKGP-UHFFFAOYSA-N.
| Molecular formula | C4H4F6O3S |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoropropan-2-yl methanesulfonate |
| InChIKey | ASXXTXSBHCZKGP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)