CAS 2413301-06-9 is the registry number for (1R)-2,2,2-TRIFLUORO-1-METHYLETHYL 1,1,1-TRIFLUOROMETHANESULFONATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(2R)-1,1,1-trifluoropropan-2-yl] trifluoromethanesulfonate (CAS 2413301-06-9) is a chemical compound with the molecular formula C4H4F6O3S and a molecular weight of 246.13 g/mol. IUPAC name: [(2R)-1,1,1-trifluoropropan-2-yl] trifluoromethanesulfonate. InChIKey: CCCKOEYCRHBDDH-UWTATZPHSA-N.
| Molecular formula | C4H4F6O3S |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | [(2R)-1,1,1-trifluoropropan-2-yl] trifluoromethanesulfonate |
| InChIKey | CCCKOEYCRHBDDH-UWTATZPHSA-N |
| SMILES | C[C@H](C(F)(F)F)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)