CAS 212557-00-1 is the registry number for (S)-Benzyl 2-(hydroxymethyl)piperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
Benzyl (2S)-2-(hydroxymethyl)piperidine-1-carboxylate (CAS 212557-00-1) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: benzyl (2S)-2-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: UDGDHNGWPNSYCD-ZDUSSCGKSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | benzyl (2S)-2-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | UDGDHNGWPNSYCD-ZDUSSCGKSA-N |
| SMILES | C1CCN([C@@H](C1)CO)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)